C19H14ClN3O6S — CID 2861286
1-(4-chlorophenyl)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 2861286) has the molecular formula C19H14ClN3O6S and a molecular weight of 447.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 2861286 |
| Molecular Formula | C19H14ClN3O6S |
| Molecular Weight | 447.86 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cc(C=C2C(=O)NC(=S)N(c3ccc(Cl)cc3)C2=O)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H14ClN3O6S/c1-28-15-8-10(14(23(26)27)9-16(15)29-2)7-13-17(24)21-19(30)22(18(13)25)12-5-3-11(20)4-6-12/h3-9H,1-2H3,(H,21,24,30) |
| InChIKey | AHHZAWKSCVKFEM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|