C18H11ClN3O7- — CID 2267283
2-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxy-4-nitrophenolate (PubChem CID 2267283) has the molecular formula C18H11ClN3O7- and a molecular weight of 416.75 g/mol. Its IUPAC name is 2-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxy-4-nitrophenolate.
| Compound Name | 2-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxy-4-nitrophenolate |
|---|---|
| PubChem CID | 2267283 |
| Molecular Formula | C18H11ClN3O7- |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-[(E)-[1-(4-chlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxy-4-nitrophenolate |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=C2\C(=O)NC(=O)N(c3ccc(Cl)cc3)C2=O)c1[O-] |
| InChI | InChI=1S/C18H12ClN3O7/c1-29-14-8-12(22(27)28)6-9(15(14)23)7-13-16(24)20-18(26)21(17(13)25)11-4-2-10(19)3-5-11/h2-8,23H,1H3,(H,20,24,26)/p-1/b13-7+ |
| InChIKey | KDYSIWUHBUPDMJ-NTUHNPAUSA-M |
| XLogP | 2.00 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|