C18H12N4O8 — CID 96885214
(5E)-5-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 96885214) has the molecular formula C18H12N4O8 and a molecular weight of 412.31 g/mol. Its IUPAC name is (5E)-5-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 96885214 |
| Molecular Formula | C18H12N4O8 |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (5E)-5-[(2-hydroxy-3,5-dinitrophenyl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(N2C(=O)NC(=O)/C(=C\c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3O)C2=O)cc1 |
| InChI | InChI=1S/C18H12N4O8/c1-9-2-4-11(5-3-9)20-17(25)13(16(24)19-18(20)26)7-10-6-12(21(27)28)8-14(15(10)23)22(29)30/h2-8,23H,1H3,(H,19,24,26)/b13-7+ |
| InChIKey | XTBTXEWOOVMMOM-NTUHNPAUSA-N |
| XLogP | 2.18 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|