C18H13BrN2O5 — CID 6737633
5-[(5-bromo-2,4-dihydroxyphenyl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 6737633) has the molecular formula C18H13BrN2O5 and a molecular weight of 417.22 g/mol. Its IUPAC name is 5-[(5-bromo-2,4-dihydroxyphenyl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(5-bromo-2,4-dihydroxyphenyl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6737633 |
| Molecular Formula | C18H13BrN2O5 |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 5-[(5-bromo-2,4-dihydroxyphenyl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(N2C(=O)NC(=O)C(=Cc3cc(Br)c(O)cc3O)C2=O)cc1 |
| InChI | InChI=1S/C18H13BrN2O5/c1-9-2-4-11(5-3-9)21-17(25)12(16(24)20-18(21)26)6-10-7-13(19)15(23)8-14(10)22/h2-8,22-23H,1H3,(H,20,24,26) |
| InChIKey | JTHUKYPIJRWRPW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|