C21H14N2O6 — CID 6840039
5-[(7-hydroxy-4-oxochromen-3-yl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 6840039) has the molecular formula C21H14N2O6 and a molecular weight of 390.35 g/mol. Its IUPAC name is 5-[(7-hydroxy-4-oxochromen-3-yl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(7-hydroxy-4-oxochromen-3-yl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6840039 |
| Molecular Formula | C21H14N2O6 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 5-[(7-hydroxy-4-oxochromen-3-yl)methylidene]-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(N2C(=O)NC(=O)C(=Cc3coc4cc(O)ccc4c3=O)C2=O)cc1 |
| InChI | InChI=1S/C21H14N2O6/c1-11-2-4-13(5-3-11)23-20(27)16(19(26)22-21(23)28)8-12-10-29-17-9-14(24)6-7-15(17)18(12)25/h2-10,24H,1H3,(H,22,26,28) |
| InChIKey | YOWDCCPCSFSALF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|