C13H10N3O7- — CID 2258318
2-methoxy-6-[(Z)-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-4-nitrophenolate (PubChem CID 2258318) has the molecular formula C13H10N3O7- and a molecular weight of 320.24 g/mol. Its IUPAC name is 2-methoxy-6-[(Z)-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-4-nitrophenolate.
| Compound Name | 2-methoxy-6-[(Z)-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 2258318 |
| Molecular Formula | C13H10N3O7- |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-methoxy-6-[(Z)-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-4-nitrophenolate |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=C2/C(=O)NC(=O)N(C)C2=O)c1[O-] |
| InChI | InChI=1S/C13H11N3O7/c1-15-12(19)8(11(18)14-13(15)20)4-6-3-7(16(21)22)5-9(23-2)10(6)17/h3-5,17H,1-2H3,(H,14,18,20)/p-1/b8-4- |
| InChIKey | VPEALICDLDXGOA-YWEYNIOJSA-M |
| XLogP | -0.23 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|