C13H11N2O5S2- — CID 2251827
2-ethoxy-6-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-nitrophenolate (PubChem CID 2251827) has the molecular formula C13H11N2O5S2- and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-ethoxy-6-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-nitrophenolate.
| Compound Name | 2-ethoxy-6-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 2251827 |
| Molecular Formula | C13H11N2O5S2- |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-ethoxy-6-[(E)-(3-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4-nitrophenolate |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=C2/SC(=S)N(C)C2=O)c1[O-] |
| InChI | InChI=1S/C13H12N2O5S2/c1-3-20-9-6-8(15(18)19)4-7(11(9)16)5-10-12(17)14(2)13(21)22-10/h4-6,16H,3H2,1-2H3/p-1/b10-5+ |
| InChIKey | RGCITLDCUZLGJV-BJMVGYQFSA-M |
| XLogP | 1.90 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|