C20H17N2O5S2- — CID 2286262
2-ethoxy-4-nitro-6-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate (PubChem CID 2286262) has the molecular formula C20H17N2O5S2- and a molecular weight of 429.50 g/mol. Its IUPAC name is 2-ethoxy-4-nitro-6-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate.
| Compound Name | 2-ethoxy-4-nitro-6-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate |
|---|---|
| PubChem CID | 2286262 |
| Molecular Formula | C20H17N2O5S2- |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-ethoxy-4-nitro-6-[(Z)-[4-oxo-3-(2-phenylethyl)-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenolate |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=C2\SC(=S)N(CCc3ccccc3)C2=O)c1[O-] |
| InChI | InChI=1S/C20H18N2O5S2/c1-2-27-16-12-15(22(25)26)10-14(18(16)23)11-17-19(24)21(20(28)29-17)9-8-13-6-4-3-5-7-13/h3-7,10-12,23H,2,8-9H2,1H3/p-1/b17-11- |
| InChIKey | DGRJKAWNZDOSQR-BOPFTXTBSA-M |
| XLogP | 3.51 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|