C18H13ClN2O4S — CID 126207781
(5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126207781) has the molecular formula C18H13ClN2O4S and a molecular weight of 388.83 g/mol. Its IUPAC name is (5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126207781 |
| Molecular Formula | C18H13ClN2O4S |
| Molecular Weight | 388.83 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (5Z)-5-[(2-chloro-5-nitrophenyl)methylidene]-3-(2-phenylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cc([N+](=O)[O-])ccc2Cl)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C18H13ClN2O4S/c19-15-7-6-14(21(24)25)10-13(15)11-16-17(22)20(18(23)26-16)9-8-12-4-2-1-3-5-12/h1-7,10-11H,8-9H2/b16-11- |
| InChIKey | MLMHABGAKNZNCR-WJDWOHSUSA-N |
| XLogP | 4.53 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.83 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|