C20H16ClNO4S — CID 126139874
(5E)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126139874) has the molecular formula C20H16ClNO4S and a molecular weight of 401.87 g/mol. Its IUPAC name is (5E)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126139874 |
| Molecular Formula | C20H16ClNO4S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (5E)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2cc3c(cc2Cl)OCO3)C(=O)N1CCCc1ccccc1 |
| InChI | InChI=1S/C20H16ClNO4S/c21-15-11-17-16(25-12-26-17)9-14(15)10-18-19(23)22(20(24)27-18)8-4-7-13-5-2-1-3-6-13/h1-3,5-6,9-11H,4,7-8,12H2/b18-10+ |
| InChIKey | MKAJDJHXZZVLCJ-VCHYOVAHSA-N |
| XLogP | 4.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|