C19H15ClFNO2S — CID 126136416
(5E)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126136416) has the molecular formula C19H15ClFNO2S and a molecular weight of 375.85 g/mol. Its IUPAC name is (5E)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126136416 |
| Molecular Formula | C19H15ClFNO2S |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (5E)-5-[(2-chloro-6-fluorophenyl)methylidene]-3-(3-phenylpropyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2c(F)cccc2Cl)C(=O)N1CCCc1ccccc1 |
| InChI | InChI=1S/C19H15ClFNO2S/c20-15-9-4-10-16(21)14(15)12-17-18(23)22(19(24)25-17)11-5-8-13-6-2-1-3-7-13/h1-4,6-7,9-10,12H,5,8,11H2/b17-12+ |
| InChIKey | KJZWUJBCRDGGLS-SFQUDFHCSA-N |
| XLogP | 5.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|