C14H12N3O7- — CID 7115478
4-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-methoxy-6-nitrophenolate (PubChem CID 7115478) has the molecular formula C14H12N3O7- and a molecular weight of 334.26 g/mol. Its IUPAC name is 4-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 7115478 |
| Molecular Formula | C14H12N3O7- |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(C=C2C(=O)N(C)C(=O)N(C)C2=O)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C14H13N3O7/c1-15-12(19)8(13(20)16(2)14(15)21)4-7-5-9(17(22)23)11(18)10(6-7)24-3/h4-6,18H,1-3H3/p-1 |
| InChIKey | APFKHCJPFFAUOI-UHFFFAOYSA-M |
| XLogP | 0.11 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|