C19H14N3O6S- — CID 2267201
2-methoxy-4-[(Z)-[1-(2-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-nitrophenolate (PubChem CID 2267201) has the molecular formula C19H14N3O6S- and a molecular weight of 412.40 g/mol. Its IUPAC name is 2-methoxy-4-[(Z)-[1-(2-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-nitrophenolate.
| Compound Name | 2-methoxy-4-[(Z)-[1-(2-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 2267201 |
| Molecular Formula | C19H14N3O6S- |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-methoxy-4-[(Z)-[1-(2-methylphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-nitrophenolate |
| SMILES | COc1cc(/C=C2/C(=O)NC(=S)N(c3ccccc3C)C2=O)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C19H15N3O6S/c1-10-5-3-4-6-13(10)21-18(25)12(17(24)20-19(21)29)7-11-8-14(22(26)27)16(23)15(9-11)28-2/h3-9,23H,1-2H3,(H,20,24,29)/p-1/b12-7- |
| InChIKey | RIUTVPMKUXSEDV-GHXNOFRVSA-M |
| XLogP | 1.82 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|