C21H18N3O7- — CID 2283542
4-[(E)-[1-(2,5-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-nitrophenolate (PubChem CID 2283542) has the molecular formula C21H18N3O7- and a molecular weight of 424.39 g/mol. Its IUPAC name is 4-[(E)-[1-(2,5-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-[1-(2,5-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 2283542 |
| Molecular Formula | C21H18N3O7- |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-[(E)-[1-(2,5-dimethylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-nitrophenolate |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3cc(C)ccc3C)C2=O)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C21H19N3O7/c1-4-31-17-10-13(9-16(18(17)25)24(29)30)8-14-19(26)22-21(28)23(20(14)27)15-7-11(2)5-6-12(15)3/h5-10,25H,4H2,1-3H3,(H,22,26,28)/p-1/b14-8+ |
| InChIKey | WIPCFEVCPANGHO-RIYZIHGNSA-M |
| XLogP | 2.35 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|