C13H14N5O4S- — CID 7728749
2-methoxy-6-nitro-4-[(Z)-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenolate (PubChem CID 7728749) has the molecular formula C13H14N5O4S- and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-methoxy-6-nitro-4-[(Z)-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenolate.
| Compound Name | 2-methoxy-6-nitro-4-[(Z)-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenolate |
|---|---|
| PubChem CID | 7728749 |
| Molecular Formula | C13H14N5O4S- |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-methoxy-6-nitro-4-[(Z)-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]phenolate |
| SMILES | COc1cc(/C=N\n2c(C(C)C)n[nH]c2=S)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C13H15N5O4S/c1-7(2)12-15-16-13(23)17(12)14-6-8-4-9(18(20)21)11(19)10(5-8)22-3/h4-7,19H,1-3H3,(H,16,23)/p-1/b14-6- |
| InChIKey | CRJCXGVFCROYOO-NSIKDUERSA-M |
| XLogP | 1.94 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|