C13H12N3O5S- — CID 2179344
2-[(E)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-methoxy-4-nitrophenolate (PubChem CID 2179344) has the molecular formula C13H12N3O5S- and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-[(E)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-methoxy-4-nitrophenolate.
| Compound Name | 2-[(E)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-methoxy-4-nitrophenolate |
|---|---|
| PubChem CID | 2179344 |
| Molecular Formula | C13H12N3O5S- |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-[(E)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-methoxy-4-nitrophenolate |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=C2\C(=O)N(C)C(=S)N2C)c1[O-] |
| InChI | InChI=1S/C13H13N3O5S/c1-14-9(12(18)15(2)13(14)22)5-7-4-8(16(19)20)6-10(21-3)11(7)17/h4-6,17H,1-3H3/p-1/b9-5+ |
| InChIKey | LQLUDOIONSJJJL-WEVVVXLNSA-M |
| XLogP | 0.71 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|