C14H15BrN2O3S — CID 2179405
(5Z)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 2179405) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is (5Z)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2179405 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | (5Z)-5-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(OC)c(/C=C2/C(=O)N(C)C(=S)N2C)cc1Br |
| InChI | InChI=1S/C14H15BrN2O3S/c1-16-10(13(18)17(2)14(16)21)6-8-5-9(15)12(20-4)7-11(8)19-3/h5-7H,1-4H3/b10-6- |
| InChIKey | SDDOZMJEVQRMLO-POHAHGRESA-N |
| XLogP | 2.50 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|