C16H15BrN2O3S — CID 2933413
5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 2933413) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is 5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2933413 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 5-[(3-bromo-5-methoxy-4-prop-2-ynoxyphenyl)methylidene]-1,3-dimethyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | C#CCOc1c(Br)cc(C=C2C(=O)N(C)C(=S)N2C)cc1OC |
| InChI | InChI=1S/C16H15BrN2O3S/c1-5-6-22-14-11(17)7-10(9-13(14)21-4)8-12-15(20)19(3)16(23)18(12)2/h1,7-9H,6H2,2-4H3 |
| InChIKey | OSKOKUULIRBOAR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|