C15H15ClN2O5S — CID 126037061
2-[2-chloro-4-[(Z)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 126037061) has the molecular formula C15H15ClN2O5S and a molecular weight of 370.81 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(Z)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126037061 |
| Molecular Formula | C15H15ClN2O5S |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-(1,3-dimethyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C2/C(=O)N(C)C(=S)N2C)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C15H15ClN2O5S/c1-17-10(14(21)18(2)15(17)24)5-8-4-9(16)13(11(6-8)22-3)23-7-12(19)20/h4-6H,7H2,1-3H3,(H,19,20)/b10-5- |
| InChIKey | GXDOYMWALWTIOV-YHYXMXQVSA-N |
| XLogP | 1.84 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|