C26H17Cl2N3O7S — CID 91225936
5-[[2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-5-nitrophenyl]methylidene]-1-(4-chlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91225936) has the molecular formula C26H17Cl2N3O7S and a molecular weight of 586.41 g/mol. Its IUPAC name is 5-[[2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-5-nitrophenyl]methylidene]-1-(4-chlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-5-nitrophenyl]methylidene]-1-(4-chlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91225936 |
| Molecular Formula | C26H17Cl2N3O7S |
| Molecular Weight | 586.41 g/mol |
| Exact Mass | 585.02 |
| IUPAC Name | 5-[[2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-5-nitrophenyl]methylidene]-1-(4-chlorophenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)N(c2ccc(Cl)cc2)C(=O)C1=Cc1cc([N+](=O)[O-])ccc1OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C26H17Cl2N3O7S/c27-17-1-3-19(4-2-17)30-25(33)21(24(32)29-26(30)39)10-14-9-20(31(34)35)5-6-22(14)37-12-16-8-18(28)7-15-11-36-13-38-23(15)16/h1-10H,11-13H2,(H,29,32,39) |
| InChIKey | DECXHAYMWUPJPN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|