C18H14ClNO7 — CID 170872237
(E)-3-[2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-5-nitrophenyl]prop-2-enoic acid (PubChem CID 170872237) has the molecular formula C18H14ClNO7 and a molecular weight of 391.76 g/mol. Its IUPAC name is (E)-3-[2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-5-nitrophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-5-nitrophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170872237 |
| Molecular Formula | C18H14ClNO7 |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | (E)-3-[2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-5-nitrophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc([N+](=O)[O-])ccc1OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C18H14ClNO7/c19-14-5-12-8-25-10-27-18(12)13(6-14)9-26-16-3-2-15(20(23)24)7-11(16)1-4-17(21)22/h1-7H,8-10H2,(H,21,22)/b4-1+ |
| InChIKey | DOJQOXQWWYNOKE-DAFODLJHSA-N |
| XLogP | 3.79 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|