C13H10N2O6 — CID 60873645
(E)-3-[5-nitro-2-(1,2-oxazol-4-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 60873645) has the molecular formula C13H10N2O6 and a molecular weight of 290.23 g/mol. Its IUPAC name is (E)-3-[5-nitro-2-(1,2-oxazol-4-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-nitro-2-(1,2-oxazol-4-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 60873645 |
| Molecular Formula | C13H10N2O6 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (E)-3-[5-nitro-2-(1,2-oxazol-4-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc([N+](=O)[O-])ccc1OCc1cnoc1 |
| InChI | InChI=1S/C13H10N2O6/c16-13(17)4-1-10-5-11(15(18)19)2-3-12(10)20-7-9-6-14-21-8-9/h1-6,8H,7H2,(H,16,17)/b4-1+ |
| InChIKey | GKHKPKSHVLDBNH-DAFODLJHSA-N |
| XLogP | 2.26 |
| TPSA | 115.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|