C18H16O5 — CID 57319289
3-[5-(carboxymethyl)-2-phenylmethoxyphenyl]prop-2-enoic acid (PubChem CID 57319289) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is 3-[5-(carboxymethyl)-2-phenylmethoxyphenyl]prop-2-enoic acid.
| Compound Name | 3-[5-(carboxymethyl)-2-phenylmethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 57319289 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 3-[5-(carboxymethyl)-2-phenylmethoxyphenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cc(CC(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H16O5/c19-17(20)9-7-15-10-14(11-18(21)22)6-8-16(15)23-12-13-4-2-1-3-5-13/h1-10H,11-12H2,(H,19,20)(H,21,22) |
| InChIKey | DZODDPWUFIZPJI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|