C18H17ClO5 — CID 7611233
4-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-ethoxybenzaldehyde (PubChem CID 7611233) has the molecular formula C18H17ClO5 and a molecular weight of 348.78 g/mol. Its IUPAC name is 4-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-ethoxybenzaldehyde.
| Compound Name | 4-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-ethoxybenzaldehyde |
|---|---|
| PubChem CID | 7611233 |
| Molecular Formula | C18H17ClO5 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]-3-ethoxybenzaldehyde |
| SMILES | CCOc1cc(C=O)ccc1OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C18H17ClO5/c1-2-22-17-5-12(8-20)3-4-16(17)23-10-14-7-15(19)6-13-9-21-11-24-18(13)14/h3-8H,2,9-11H2,1H3 |
| InChIKey | IDNFDFINESPWLO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|