C24H28N2O7 — CID 146095615
1-(3,6-dihydro-2H-pyran-5-yl)-N-[[3-ethoxy-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]methyl]methanamine (PubChem CID 146095615) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyran-5-yl)-N-[[3-ethoxy-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]methyl]methanamine.
| Compound Name | 1-(3,6-dihydro-2H-pyran-5-yl)-N-[[3-ethoxy-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 146095615 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyran-5-yl)-N-[[3-ethoxy-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]methyl]methanamine |
| SMILES | CCOc1cc(CNCC2=CCCOC2)ccc1OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C24H28N2O7/c1-2-31-23-8-17(11-25-12-18-4-3-7-29-13-18)5-6-22(23)32-15-20-10-21(26(27)28)9-19-14-30-16-33-24(19)20/h4-6,8-10,25H,2-3,7,11-16H2,1H3 |
| InChIKey | JDVJVZAEYXCYSD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|