C31H25N3O7 — CID 98395430
(Z)-2-cyano-3-[3-ethoxy-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]-N-naphthalen-1-ylprop-2-enamide (PubChem CID 98395430) has the molecular formula C31H25N3O7 and a molecular weight of 551.56 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-ethoxy-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]-N-naphthalen-1-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-ethoxy-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]-N-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 98395430 |
| Molecular Formula | C31H25N3O7 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | (Z)-2-cyano-3-[3-ethoxy-4-[(6-nitro-4H-1,3-benzodioxin-8-yl)methoxy]phenyl]-N-naphthalen-1-ylprop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc3ccccc23)ccc1OCc1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C31H25N3O7/c1-2-39-29-13-20(12-22(16-32)31(35)33-27-9-5-7-21-6-3-4-8-26(21)27)10-11-28(29)40-18-24-15-25(34(36)37)14-23-17-38-19-41-30(23)24/h3-15H,2,17-19H2,1H3,(H,33,35)/b22-12- |
| InChIKey | LIQNSMYEIRLEPT-UUYOSTAYSA-N |
| XLogP | 6.14 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|