C26H24N2O6 — CID 5020644
5-[[4-[2-cyano-3-(2-ethylanilino)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 5020644) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is 5-[[4-[2-cyano-3-(2-ethylanilino)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[2-cyano-3-(2-ethylanilino)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 5020644 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 5-[[4-[2-cyano-3-(2-ethylanilino)-3-oxoprop-1-enyl]-2-ethoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2ccccc2CC)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C26H24N2O6/c1-3-18-7-5-6-8-21(18)28-25(29)19(15-27)13-17-9-11-22(24(14-17)32-4-2)33-16-20-10-12-23(34-20)26(30)31/h5-14H,3-4,16H2,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | GVZSWQVMRBDAQF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 121.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|