C24H17ClN4O7 — CID 126089896
(E)-N-(2-chlorophenyl)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]prop-2-enamide (PubChem CID 126089896) has the molecular formula C24H17ClN4O7 and a molecular weight of 508.87 g/mol. Its IUPAC name is (E)-N-(2-chlorophenyl)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-chlorophenyl)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126089896 |
| Molecular Formula | C24H17ClN4O7 |
| Molecular Weight | 508.87 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | (E)-N-(2-chlorophenyl)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2ccccc2Cl)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H17ClN4O7/c1-2-35-23-12-15(11-16(14-26)24(30)27-19-6-4-3-5-18(19)25)7-9-22(23)36-21-10-8-17(28(31)32)13-20(21)29(33)34/h3-13H,2H2,1H3,(H,27,30)/b16-11+ |
| InChIKey | SSTJMBHRIPBXCT-LFIBNONCSA-N |
| XLogP | 5.89 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.87 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|