C22H11Cl3N4O6 — CID 126088756
(E)-N-(2-chlorophenyl)-2-cyano-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]prop-2-enamide (PubChem CID 126088756) has the molecular formula C22H11Cl3N4O6 and a molecular weight of 533.71 g/mol. Its IUPAC name is (E)-N-(2-chlorophenyl)-2-cyano-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-chlorophenyl)-2-cyano-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126088756 |
| Molecular Formula | C22H11Cl3N4O6 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 531.97 |
| IUPAC Name | (E)-N-(2-chlorophenyl)-2-cyano-3-[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Cl)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H11Cl3N4O6/c23-14-8-12(7-13(11-26)22(30)27-18-4-2-1-3-16(18)24)21(17(25)9-14)35-20-6-5-15(28(31)32)10-19(20)29(33)34/h1-10H,(H,27,30)/b13-7+ |
| InChIKey | SLDGIAQYKGYPDF-NTUHNPAUSA-N |
| XLogP | 6.80 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|