C15H17ClN2O3 — CID 115582251
4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methoxy]-3-ethoxybenzaldehyde (PubChem CID 115582251) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methoxy]-3-ethoxybenzaldehyde.
| Compound Name | 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methoxy]-3-ethoxybenzaldehyde |
|---|---|
| PubChem CID | 115582251 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-[(5-chloro-1,3-dimethylpyrazol-4-yl)methoxy]-3-ethoxybenzaldehyde |
| SMILES | CCOc1cc(C=O)ccc1OCc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C15H17ClN2O3/c1-4-20-14-7-11(8-19)5-6-13(14)21-9-12-10(2)17-18(3)15(12)16/h5-8H,4,9H2,1-3H3 |
| InChIKey | IBQAWQNGSJWTCK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|