C11H11Cl2N3O — CID 115634537
2-chloro-3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methoxy]pyridine (PubChem CID 115634537) has the molecular formula C11H11Cl2N3O and a molecular weight of 272.13 g/mol. Its IUPAC name is 2-chloro-3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methoxy]pyridine.
| Compound Name | 2-chloro-3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methoxy]pyridine |
|---|---|
| PubChem CID | 115634537 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 2-chloro-3-[(5-chloro-1,3-dimethylpyrazol-4-yl)methoxy]pyridine |
| SMILES | Cc1nn(C)c(Cl)c1COc1cccnc1Cl |
| InChI | InChI=1S/C11H11Cl2N3O/c1-7-8(11(13)16(2)15-7)6-17-9-4-3-5-14-10(9)12/h3-5H,6H2,1-2H3 |
| InChIKey | JMYPQLIZFGKDGD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|