C18H14Cl2N2O4 — CID 30029315
4-[[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-3-ethoxybenzaldehyde (PubChem CID 30029315) has the molecular formula C18H14Cl2N2O4 and a molecular weight of 393.23 g/mol. Its IUPAC name is 4-[[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-3-ethoxybenzaldehyde.
| Compound Name | 4-[[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-3-ethoxybenzaldehyde |
|---|---|
| PubChem CID | 30029315 |
| Molecular Formula | C18H14Cl2N2O4 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 4-[[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]methoxy]-3-ethoxybenzaldehyde |
| SMILES | CCOc1cc(C=O)ccc1OCc1nc(-c2ccc(Cl)c(Cl)c2)no1 |
| InChI | InChI=1S/C18H14Cl2N2O4/c1-2-24-16-7-11(9-23)3-6-15(16)25-10-17-21-18(22-26-17)12-4-5-13(19)14(20)8-12/h3-9H,2,10H2,1H3 |
| InChIKey | PEOFAGVLSVPUOS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|