C9H4Cl2N2O2 — CID 81492192
3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 81492192) has the molecular formula C9H4Cl2N2O2 and a molecular weight of 243.05 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde.
| Compound Name | 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 81492192 |
| Molecular Formula | C9H4Cl2N2O2 |
| Molecular Weight | 243.05 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | O=Cc1nc(-c2ccc(Cl)c(Cl)c2)no1 |
| InChI | InChI=1S/C9H4Cl2N2O2/c10-6-2-1-5(3-7(6)11)9-12-8(4-14)15-13-9/h1-4H |
| InChIKey | OHRSHYHXGFNWIF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.05 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|