3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid

C9H4Cl2N2O3 — CID 83395279

IUPAC3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid
SMILESO=C(O)c1nc(-c2ccc(Cl)c(Cl)c2)no1
InChIInChI=1S/C9H4Cl2N2O3/c10-5-2-1-4(3-6(5)11)7-12-8(9(14)15)16-13-7/h1-3H,(H,14,15)
InChIKeySXWLFOSIQQGOHJ-UHFFFAOYSA-N
MW259.05 g/mol
LogP2.74
Rot. Bonds2

About 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid

3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid (PubChem CID 83395279) has the molecular formula C9H4Cl2N2O3 and a molecular weight of 259.05 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid
PubChem CID83395279
Molecular FormulaC9H4Cl2N2O3
Molecular Weight259.05 g/mol
Exact Mass257.96
IUPAC Name3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid
SMILESO=C(O)c1nc(-c2ccc(Cl)c(Cl)c2)no1
InChIInChI=1S/C9H4Cl2N2O3/c10-5-2-1-4(3-6(5)11)7-12-8(9(14)15)16-13-7/h1-3H,(H,14,15)
InChIKeySXWLFOSIQQGOHJ-UHFFFAOYSA-N
XLogP2.74
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.05
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid?
The IUPAC name of 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid (CID 83395279) is 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid?
The canonical SMILES for 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid is O=C(O)c1nc(-c2ccc(Cl)c(Cl)c2)no1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid?
The InChIKey is SXWLFOSIQQGOHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Cl2N2O3/c10-5-2-1-4(3-6(5)11)7-12-8(9(14)15)16-13-7/h1-3H,(H,14,15).
What are the key properties of 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid?
3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid has a molecular weight of 259.05 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylic acid is sourced from PubChem (CID 83395279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).