C13H15Cl2N3O — CID 81491734
2-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentan-2-amine (PubChem CID 81491734) has the molecular formula C13H15Cl2N3O and a molecular weight of 300.19 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentan-2-amine.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentan-2-amine |
|---|---|
| PubChem CID | 81491734 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pentan-2-amine |
| SMILES | CCCC(C)(N)c1nc(-c2ccc(Cl)c(Cl)c2)no1 |
| InChI | InChI=1S/C13H15Cl2N3O/c1-3-6-13(2,16)12-17-11(18-19-12)8-4-5-9(14)10(15)7-8/h4-5,7H,3,6,16H2,1-2H3 |
| InChIKey | DWHSJCPEWGTUMR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |