C14H19N3O3 — CID 79799127
2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-amine (PubChem CID 79799127) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-amine.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-amine |
|---|---|
| PubChem CID | 79799127 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-amine |
| SMILES | CCC(C)(N)c1nc(-c2ccc(OC)c(OC)c2)no1 |
| InChI | InChI=1S/C14H19N3O3/c1-5-14(2,15)13-16-12(17-20-13)9-6-7-10(18-3)11(8-9)19-4/h6-8H,5,15H2,1-4H3 |
| InChIKey | SYCAPIXNEFGTBV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |