2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid

C16H13ClO5 — CID 45394172

IUPAC2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCc1cc(Cl)cc2c1OCOC2
InChIInChI=1S/C16H13ClO5/c17-12-5-10-7-20-9-22-15(10)11(6-12)8-21-14-4-2-1-3-13(14)16(18)19/h1-6H,7-9H2,(H,18,19)
InChIKeyJYNHAIDKHJCPKM-UHFFFAOYSA-N
MW320.73 g/mol
LogP3.48
Rot. Bonds4

About 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid

2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid (PubChem CID 45394172) has the molecular formula C16H13ClO5 and a molecular weight of 320.73 g/mol. Its IUPAC name is 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid.

Molecular Properties

Compound Name2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid
PubChem CID45394172
Molecular FormulaC16H13ClO5
Molecular Weight320.73 g/mol
Exact Mass320.05
IUPAC Name2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCc1cc(Cl)cc2c1OCOC2
InChIInChI=1S/C16H13ClO5/c17-12-5-10-7-20-9-22-15(10)11(6-12)8-21-14-4-2-1-3-13(14)16(18)19/h1-6H,7-9H2,(H,18,19)
InChIKeyJYNHAIDKHJCPKM-UHFFFAOYSA-N
XLogP3.48
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.73
LogP ≤ 53.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid?
The IUPAC name of 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid (CID 45394172) is 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid.
What is the SMILES notation for 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid?
The canonical SMILES for 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid is O=C(O)c1ccccc1OCc1cc(Cl)cc2c1OCOC2.
What is the InChIKey of 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid?
The InChIKey is JYNHAIDKHJCPKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClO5/c17-12-5-10-7-20-9-22-15(10)11(6-12)8-21-14-4-2-1-3-13(14)16(18)19/h1-6H,7-9H2,(H,18,19).
What are the key properties of 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid?
2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid has a molecular weight of 320.73 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid is sourced from PubChem (CID 45394172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).