C16H13ClO5 — CID 45394172
2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid (PubChem CID 45394172) has the molecular formula C16H13ClO5 and a molecular weight of 320.73 g/mol. Its IUPAC name is 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid.
| Compound Name | 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 45394172 |
| Molecular Formula | C16H13ClO5 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[(6-chloro-4H-1,3-benzodioxin-8-yl)methoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1OCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C16H13ClO5/c17-12-5-10-7-20-9-22-15(10)11(6-12)8-21-14-4-2-1-3-13(14)16(18)19/h1-6H,7-9H2,(H,18,19) |
| InChIKey | JYNHAIDKHJCPKM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |