C18H17N3O3S2 — CID 126339627
(5Z)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-3-propyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126339627) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-3-propyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-3-propyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126339627 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (5Z)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-3-propyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCN1C(=O)/C(=C/c2cccn2Cc2ccccc2[N+](=O)[O-])SC1=S |
| InChI | InChI=1S/C18H17N3O3S2/c1-2-9-20-17(22)16(26-18(20)25)11-14-7-5-10-19(14)12-13-6-3-4-8-15(13)21(23)24/h3-8,10-11H,2,9,12H2,1H3/b16-11- |
| InChIKey | TZSKMMVXWPRZLW-WJDWOHSUSA-N |
| XLogP | 4.06 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|