C22H17N3O3S2 — CID 126337892
(5Z)-3-benzyl-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126337892) has the molecular formula C22H17N3O3S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126337892 |
| Molecular Formula | C22H17N3O3S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | (5Z)-3-benzyl-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cccn2Cc2ccccc2[N+](=O)[O-])SC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H17N3O3S2/c26-21-20(30-22(29)24(21)14-16-7-2-1-3-8-16)13-18-10-6-12-23(18)15-17-9-4-5-11-19(17)25(27)28/h1-13H,14-15H2/b20-13- |
| InChIKey | PJEDWQHEHATSDJ-MOSHPQCFSA-N |
| XLogP | 4.85 |
| TPSA | 68.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|