C20H19N3O6S — CID 124641888
propan-2-yl 2-[(5E)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 124641888) has the molecular formula C20H19N3O6S and a molecular weight of 429.45 g/mol. Its IUPAC name is propan-2-yl 2-[(5E)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propan-2-yl 2-[(5E)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 124641888 |
| Molecular Formula | C20H19N3O6S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | propan-2-yl 2-[(5E)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC(C)OC(=O)CN1C(=O)S/C(=C/c2cccn2Cc2ccccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C20H19N3O6S/c1-13(2)29-18(24)12-22-19(25)17(30-20(22)26)10-15-7-5-9-21(15)11-14-6-3-4-8-16(14)23(27)28/h3-10,13H,11-12H2,1-2H3/b17-10+ |
| InChIKey | FUVMUNPHHJVYDG-LICLKQGHSA-N |
| XLogP | 3.43 |
| TPSA | 111.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|