C22H15N3O5S2 — CID 126345704
(5E)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126345704) has the molecular formula C22H15N3O5S2 and a molecular weight of 465.51 g/mol. Its IUPAC name is (5E)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126345704 |
| Molecular Formula | C22H15N3O5S2 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | (5E)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-nitrophenyl)methyl]pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cccn2Cc2ccccc2[N+](=O)[O-])SC(=S)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H15N3O5S2/c26-21-20(32-22(31)24(21)16-7-8-18-19(10-16)30-13-29-18)11-15-5-3-9-23(15)12-14-4-1-2-6-17(14)25(27)28/h1-11H,12-13H2/b20-11+ |
| InChIKey | WJCPXNMTIGLNBL-RGVLZGJSSA-N |
| XLogP | 4.58 |
| TPSA | 86.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|