C26H17ClN2O3S2 — CID 126334744
(5E)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126334744) has the molecular formula C26H17ClN2O3S2 and a molecular weight of 505.02 g/mol. Its IUPAC name is (5E)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126334744 |
| Molecular Formula | C26H17ClN2O3S2 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | (5E)-3-(1,3-benzodioxol-5-yl)-5-[[1-[(2-chlorophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cn(Cc3ccccc3Cl)c3ccccc23)SC(=S)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H17ClN2O3S2/c27-20-7-3-1-5-16(20)13-28-14-17(19-6-2-4-8-21(19)28)11-24-25(30)29(26(33)34-24)18-9-10-22-23(12-18)32-15-31-22/h1-12,14H,13,15H2/b24-11+ |
| InChIKey | YJIFZJCKGGIEOL-BHGWPJFGSA-N |
| XLogP | 6.48 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|