C25H16Cl2N2OS2 — CID 50873222
(5E)-5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 50873222) has the molecular formula C25H16Cl2N2OS2 and a molecular weight of 495.46 g/mol. Its IUPAC name is (5E)-5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50873222 |
| Molecular Formula | C25H16Cl2N2OS2 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | (5E)-5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cn(Cc3c(Cl)cccc3Cl)c3ccccc23)SC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C25H16Cl2N2OS2/c26-20-10-6-11-21(27)19(20)15-28-14-16(18-9-4-5-12-22(18)28)13-23-24(30)29(25(31)32-23)17-7-2-1-3-8-17/h1-14H,15H2/b23-13+ |
| InChIKey | JSGGUPSOHIEHNZ-YDZHTSKRSA-N |
| XLogP | 7.40 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|