C26H18Cl2N2OS2 — CID 3820907
3-benzyl-5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3820907) has the molecular formula C26H18Cl2N2OS2 and a molecular weight of 509.48 g/mol. Its IUPAC name is 3-benzyl-5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-benzyl-5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3820907 |
| Molecular Formula | C26H18Cl2N2OS2 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 3-benzyl-5-[[1-[(2,6-dichlorophenyl)methyl]indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cn(Cc3c(Cl)cccc3Cl)c3ccccc23)SC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H18Cl2N2OS2/c27-21-10-6-11-22(28)20(21)16-29-15-18(19-9-4-5-12-23(19)29)13-24-25(31)30(26(32)33-24)14-17-7-2-1-3-8-17/h1-13,15H,14,16H2 |
| InChIKey | ALEMTXZRGKJNSG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|