C25H15Cl2FN2OS2 — CID 2717358
(5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 2717358) has the molecular formula C25H15Cl2FN2OS2 and a molecular weight of 513.45 g/mol. Its IUPAC name is (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2717358 |
| Molecular Formula | C25H15Cl2FN2OS2 |
| Molecular Weight | 513.45 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | (5Z)-5-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-3-(3-fluorophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2cn(Cc3ccc(Cl)cc3Cl)c3ccccc23)SC(=S)N1c1cccc(F)c1 |
| InChI | InChI=1S/C25H15Cl2FN2OS2/c26-17-9-8-15(21(27)11-17)13-29-14-16(20-6-1-2-7-22(20)29)10-23-24(31)30(25(32)33-23)19-5-3-4-18(28)12-19/h1-12,14H,13H2/b23-10- |
| InChIKey | ZVQLIZRXQFBYDM-RMORIDSASA-N |
| XLogP | 7.54 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.45 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|