C27H19N2O3S2- — CID 2202083
3-[(5Z)-5-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 2202083) has the molecular formula C27H19N2O3S2- and a molecular weight of 483.59 g/mol. Its IUPAC name is 3-[(5Z)-5-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | 3-[(5Z)-5-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 2202083 |
| Molecular Formula | C27H19N2O3S2- |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 3-[(5Z)-5-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | Cc1ccccc1Cn1cc(/C=C2\SC(=S)N(c3cccc(C(=O)[O-])c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C27H20N2O3S2/c1-17-7-2-3-8-19(17)15-28-16-20(22-11-4-5-12-23(22)28)14-24-25(30)29(27(33)34-24)21-10-6-9-18(13-21)26(31)32/h2-14,16H,15H2,1H3,(H,31,32)/p-1/b24-14- |
| InChIKey | APEGBXOLABLNLO-OYKKKHCWSA-M |
| XLogP | 4.77 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|