C27H20N2O3S2 — CID 2904523
3-[5-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 2904523) has the molecular formula C27H20N2O3S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-[5-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 3-[5-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 2904523 |
| Molecular Formula | C27H20N2O3S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | 3-[5-[[1-[(2-methylphenyl)methyl]indol-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | Cc1ccccc1Cn1cc(C=C2SC(=S)N(c3cccc(C(=O)O)c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C27H20N2O3S2/c1-17-7-2-3-8-19(17)15-28-16-20(22-11-4-5-12-23(22)28)14-24-25(30)29(27(33)34-24)21-10-6-9-18(13-21)26(31)32/h2-14,16H,15H2,1H3,(H,31,32) |
| InChIKey | APEGBXOLABLNLO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|