C27H24N2OS2 — CID 50872338
(5E)-3-tert-butyl-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 50872338) has the molecular formula C27H24N2OS2 and a molecular weight of 456.64 g/mol. Its IUPAC name is (5E)-3-tert-butyl-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-tert-butyl-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50872338 |
| Molecular Formula | C27H24N2OS2 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | (5E)-3-tert-butyl-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)N1C(=O)/C(=C\c2cn(Cc3cccc4ccccc34)c3ccccc23)SC1=S |
| InChI | InChI=1S/C27H24N2OS2/c1-27(2,3)29-25(30)24(32-26(29)31)15-20-17-28(23-14-7-6-13-22(20)23)16-19-11-8-10-18-9-4-5-12-21(18)19/h4-15,17H,16H2,1-3H3/b24-15+ |
| InChIKey | LXPJZPQIXWUCKS-BUVRLJJBSA-N |
| XLogP | 6.84 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|