C23H17N3OS — CID 50872323
(5E)-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 50872323) has the molecular formula C23H17N3OS and a molecular weight of 383.48 g/mol. Its IUPAC name is (5E)-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 50872323 |
| Molecular Formula | C23H17N3OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (5E)-5-[[1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C/c1cn(Cc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C23H17N3OS/c27-22-20(24-23(28)25-22)12-17-14-26(21-11-4-3-10-19(17)21)13-16-8-5-7-15-6-1-2-9-18(15)16/h1-12,14H,13H2,(H2,24,25,27,28)/b20-12+ |
| InChIKey | DRHQVJAZYABJCJ-UDWIEESQSA-N |
| XLogP | 4.19 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|