C19H22O7 — CID 168599498
ethyl 4-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenoxy]butanoate (PubChem CID 168599498) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is ethyl 4-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenoxy]butanoate.
| Compound Name | ethyl 4-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 168599498 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | ethyl 4-[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cccc(C=C2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C19H22O7/c1-4-23-16(20)9-6-10-24-14-8-5-7-13(11-14)12-15-17(21)25-19(2,3)26-18(15)22/h5,7-8,11-12H,4,6,9-10H2,1-3H3 |
| InChIKey | PKAUTGSXPAJTTD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|